RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1682 |
| Common Name | Trans-zeatin riboside phosphate |
| Synonyms Names | trans-Zeatin riboside monophosphate |
| Formula | C15H20N5O8P2-; C15H22N5O8P |
| Formula at pH 7.2 (Predicted) | C15H20N5O8P2- |
| Molecular Weight | 431.338 |
| Structure |  |
| SMILES | CC(=CCNC1=NC=NC2=C1N=CN2C3C(C(C(O3)COP(=O)([O-])[O-])O)O)CO; C1(C(O)C(O)C(O1)COP(O)(O)=O)n2(c3(c(nc2)c(ncn3)NCC=C(C)CO)) |
| Reactions | OSR0871 OSR0913 OSR0920 OSR1002 OSR2394 OSR2666 |
| Pathways | |
|---|---|
| KEGG | rn00908 |
| Metacyc | PWY-2681 |
| Database Links | |
|---|---|
| Gramene | CPD-4206 |
| KEGG | C16430 |
| Pubchem Compound | 11561034 |
| Pubchem Substance | 47205727 |