RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1683 |
| Common Name | FMN |
| Synonyms Names | Riboflavin-5-phosphate ;Flavin mononucleotide |
| Formula | C17H21N4O9P |
| Formula at pH 7.2 (Predicted) | C17H18N4O9P3- |
| Molecular Weight | 456.344 |
| Structure |  |
| SMILES | CC1=CC2=C(C=C1C)N(CC(O)C(O)C(O)CO[P](O)(O)=O)C3=NC(=O)NC(=O)C3=N2 |
| Reactions | OSR0961 OSR1735 OSR1851 OSR2872 |
| Pathways | |
|---|---|
| KEGG | rn00910 rn00740 rn01100 |
| Metacyc | PWY-381 RIBOSYN2-PWY |
| Database Links | |
|---|---|
| KEGG | C00061 |
| ChEBI | 17621 |