RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1704 |
| Common Name | Quercetin 3-O-glucoside |
| Synonyms Names | Isoquercitrin ;2-(3,4-Dihidroxyphenyl)-3-(beta-D-glucofuranosyloxy)-5,7-dihydroxy-4H-1-benzopyran-4-one ;Isotrifoliin |
| Formula | C21H20O12 |
| Formula at pH 7.2 (Predicted) | C21H19O12- |
| Molecular Weight | 464.376 |
| Structure |  |
| SMILES | OCC1OC(Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(c(c2)O)O)C(C(C1O)O)O |
| Reactions | OSR2141 |
| Pathways | |
|---|---|
| KEGG | rn00944 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C05623 |
| ChEBI | 28299 |
| Pubchem Compound | 5280804 |
| Pubchem Substance | 7940 |