RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1706 |
| Common Name | Dihydrofolate |
| Synonyms Names | Dihydrofolic acid ;7,8-Dihydrofolate ;7,8-Dihydrofolic acid ;7,8-Dihydropteroylglutamate |
| Formula | C19H21N7O6 |
| Formula at pH 7.2 (Predicted) | C19H19N7O62- |
| Molecular Weight | 443.413 |
| Structure |  |
| SMILES | C(C1(=Nc2(c(NC1)nc(N)[nH]c2=O)))Nc3(ccc(cc3)C(=O)NC(C(O)=O)CCC(O)=O) |
| Reactions | OSR1609 OSR1963 OSR2325 OSR2358 OSR2396 OSR2427 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn00670 rn01100 rn00790 |
| Metacyc | PWY0-166 1CMET2-PWY P1-PWY PWY-3841 FOLSYN-PWY PWY-3742 PWY-6614 |
| Database Links | |
|---|---|
| KEGG | C00415 |
| ChEBI | 15633 |