RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1707 |
| Common Name | Retinyl ester |
| Synonyms Names | all-trans-Retinyl ester ;C02075 |
| Formula | C21H29O2R |
| Formula at pH 7.2 (Predicted) | C21H29O2R |
| Structure |  |
| SMILES | CC1=C(C=CC(C)=CC=CC(C)=CCOC(=O)[R])C(C)(C)CCC1 |
| Reactions | OSR2482 |
| Pathways | |
|---|---|
| KEGG | rn00830 |
| Database Links | |
|---|---|
| KEGG | C02075 |
| Pubchem Substance | 5161 |