RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1709 |
| Common Name | 2,4-dinitrophenyl-S-glutathione |
| Synonyms Names | S-2,4-dinitrophenylglutathione |
| Formula | C16H21N5O10S; C16H19N5O10S |
| Formula at pH 7.2 (Predicted) | C16H18N5O10S- |
| Molecular Weight | 475.429 |
| Structure |  |
| SMILES | O=C(NC(C(=O)NCC(=O)O)CSc1ccc(cc1[N+](=O)O)[N+](=O)O)CCC(C(=O)O)N; O=C(O)C(N)CCC(=O)NC(C(=O)NCC(=O)O)CSc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
| Reactions | OSR0921 |
| Pathways | |
|---|---|
| KEGG | rn00982 rn00480 rn00980 |
| Metacyc | PWY-4061 |