RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1714 |
| Common Name | (9Z,11E)-(13S)-13-Hydroperoxyoctadeca-9,11-dienoic acid |
| Synonyms Names | (9Z,11E)-(13S)-13-Hydroperoxyoctadeca-9,11-dienoate ;13(S)-HPODE ;13S-Hydroperoxy-9Z,11E-octadecadienoic acid ;(9Z,11E,13S)-13-hydroperoxy-9,11-octadecadienoate |
| Formula | C18H32O4 |
| Formula at pH 7.2 (Predicted) | C18H31O4- |
| Molecular Weight | 312.444 |
| Structure |  |
| SMILES | CCCCCC(OO)C=CC=CCCCCCCCC(O)=O |
| Reactions | OSR0904 OSR0907 OSR1978 |
| Pathways | |
|---|---|
| KEGG | rn00591 rn01100 rn00592 |
| Metacyc | PWY-5409 PWY-5410 PWY-735 |
| Database Links | |
|---|---|
| KEGG | C04717 |
| ChEBI | 15655 |
| Pubchem Compound | 5280720 |
| Pubchem Substance | 7289 |