RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1721 |
| Common Name | 6beta,7beta-Dihydroxykaurenoic acid |
| Synonyms Names | ent-6alpha,7alpha-Dihydroxykaur-16-en-19-oic acid |
| Formula | C20H30O4 |
| Formula at pH 7.2 (Predicted) | C20H29O4- |
| Molecular Weight | 334.45 |
| Structure |  |
| SMILES | C=C1CC23CC1CCC3C1(C(C(C2O)O)C(C)(CCC1)C(=O)O)C |
| Reactions | OSR2456 |
| Pathways | |
|---|---|
| KEGG | rn00904 |
| Database Links | |
|---|---|
| KEGG | C11876 |
| Pubchem Compound | 443468 |
| Pubchem Substance | 14038 |