RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1726 |
| Common Name | (5Z,8Z,11Z,14Z)-Icosatetraenoic acid |
| Synonyms Names | Arachidonate ;Arachidonic acid ;cis-5,8,11,14-Eicosatetraenoic acid |
| Formula | C20H32O2 |
| Formula at pH 7.2 (Predicted) | C20H31O2- |
| Molecular Weight | 304.467 |
| Structure |  |
| SMILES | CCCCCC=C/C/C=CCC=C/C/C=CCCCC(O)=O |
| Reactions | OSR1077 OSR1138 |
| Pathways | |
|---|---|
| KEGG | rn00590 rn01100 |
| Metacyc | PWY6666-1 |
| Database Links | |
|---|---|
| KEGG | C00219 |
| ChEBI | 15843 |