RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1727 |
| Common Name | delphinidin-3-O-beta-D-glucoside |
| Formula | C21H21O12 |
| Formula at pH 7.2 (Predicted) | C21H20O12 |
| Molecular Weight | 465.39 |
| Structure |  |
| SMILES | C1=C(C=C(C(=C1O)O)O)C2=C(C=C3C(=CC(=O)C=C3O2)O)OC4C(C(C(C(O4)CO)O)O)O |
| Reactions | OSR1708 OSR2202 |
| Pathways | |
|---|---|
| Metacyc | PWY-5153 |
| Database Links | |
|---|---|
| Gramene | CPD-7117 |