RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1729 |
| Common Name | myo-inositol hexakisphosphate |
| Formula | C6H18O24P6 |
| Formula at pH 7.2 (Predicted) | C6H6O24P612- |
| Structure |  |
| SMILES | [C@@H]1([C@@H]([C@@H]([C@@H]([C@H]([C@@H]1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O |
| Reactions | OSR0963 |
| Pathways | |
|---|---|
| KEGG | rn00562 |
| Metacyc | PWY-4702 PWY-4781 |