RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1742 |
| Common Name | (15S)-15-Hydroxy-5,8,11-cis-13-trans-eicosatetraenoate |
| Synonyms Names | (15S)-15-Hydroxy-5,8,11-cis-13-trans-icosatetraenoate ;(5Z,8Z,11Z,13E)-(15S)-15-Hydroxyicosa-5,8,11,13-tetraenoic acid ;15(S)-HETE |
| Formula | C20H32O3 |
| Formula at pH 7.2 (Predicted) | C20H31O3- |
| Molecular Weight | 320.466 |
| Structure |  |
| SMILES | CCCCCC(C=CC=CCC=CCC=CCCCC(=O)O)O |
| Reactions | OSR2132 |
| Pathways | |
|---|---|
| KEGG | rn00590 |
| Database Links | |
|---|---|
| KEGG | C04742 |
| ChEBI | 15558 |
| Pubchem Compound | 5280724 |
| Pubchem Substance | 7313 |