RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1747 |
| Common Name | 5,10-methenyl-thf |
| Formula | C20H22N7O6 |
| Formula at pH 7.2 (Predicted) | C20H20N7O6- |
| Structure |  |
| SMILES | [H]n2(c(N)nc1(NCC3(CN(C=[N+](c1c(=O)2)3)c4(ccc(cc4)C(=O)NC(CCC(=O)O)C(=O)O)))) |
| Reactions | OSR0971 OSR0973 OSR0992 OSR1985 OSR2370 OSR2441 |
| Pathways | |
|---|---|
| Metacyc | PWY-3841 PWY-2201 |