RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1748 |
| Common Name | 5,10-Methenyltetrahydrofolate |
| Formula | C20H22N7O6 |
| Formula at pH 7.2 (Predicted) | C20H20N7O6- |
| Molecular Weight | 456.432 |
| Structure |  |
| SMILES | C3(C1(CN(C=[N+1]1c2(c(=O)[nH]c(N)nc2N3))c4(ccc(cc4)C(=O)NC(C(O)=O)CCC(O)=O))) |
| Reactions | OSR0974 OSR1640 OSR2000 |
| Pathways | |
|---|---|
| KEGG | rn00670 rn01100 |
| Database Links | |
|---|---|
| KEGG | C00445 |
| ChEBI | 15638 |