RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1749 |
| Common Name | Isopentenyladenosine-5'-diphosphate |
| Synonyms Names | Isopentenyl-ADP |
| Formula | C15H23N5O10P2 |
| Formula at pH 7.2 (Predicted) | C15H20N5O10P23- |
| Molecular Weight | 495.318 |
| Structure |  |
| SMILES | C(OP(O)(=O)OP(O)(O)=O)C1(OC(C(O)C(O)1)n2(c3(c(nc2)c(ncn3)NCC=C(C)C))) |
| Reactions | OSR0987 OSR1041 OSR1131 OSR2462 OSR2735 |
| Pathways | |
|---|---|
| KEGG | rn00908 |
| Database Links | |
|---|---|
| Gramene | CPD-4203 |
| KEGG | C16426 |
| Pubchem Compound | 23724749 |
| Pubchem Substance | 47205723 |