RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1755 |
| Common Name | 5(S)-HPETE |
| Synonyms Names | 5(S)-Hydroperoxy-6-trans-8,11,14-cis-eicosatetraenoic acid ;(6E,8Z,11Z,14Z)-(5S)-5-Hydroperoxyeicosa-6,8,11,14-tetraenoate ;(6E,8Z,11Z,14Z)-(5S)-5-Hydroperoxyeicosa-6,8,11,14-tetraenoic acid ;(5S,6E,8Z,11Z,14Z)-5-Hydroperoxyicosa-6,8,11,14-tetraenoate |
| Formula | C20H32O4 |
| Formula at pH 7.2 (Predicted) | C20H31O4- |
| Molecular Weight | 336.466 |
| Structure |  |
| SMILES | CCCCCC=CCC=CCC=CC=CC(CCCC(=O)O)OO |
| Reactions | OSR2126 |
| Pathways | |
|---|---|
| KEGG | rn00590 |
| Database Links | |
|---|---|
| KEGG | C05356 |
| ChEBI | 15632 |
| Pubchem Compound | 5280778 |
| Pubchem Substance | 7733 |