RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1762 |
| Common Name | UDP-L-arabinose |
| Synonyms Names | UDP-L-arabinopyranose |
| Formula | C14H22N2O16P2 |
| Formula at pH 7.2 (Predicted) | C14H20N2O16P22- |
| Molecular Weight | 536.276 |
| Structure |  |
| SMILES | c1(n(c(=O)[nH]c(c1)=O)C2(OC(C(O)C2O)COP(=O)(O)OP(=O)(O)OC3(C(O)C(O)C(O)CO3))) |
| Reactions | OSR0946 OSR0955 OSR1153 OSR1854 |
| Pathways | |
|---|---|
| KEGG | rn00520 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C00935 |
| ChEBI | 17983 |
| Pubchem Compound | 23724466 |
| Pubchem Substance | 4187 |