RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1763 |
| Common Name | UDP-L-arabinofuranose |
| Formula | C14H22N2O16P2 |
| Formula at pH 7.2 (Predicted) | C14H20N2O16P22- |
| Molecular Weight | 536.276 |
| Structure |  |
| SMILES | OCC1OC(C(C1O)O)OP(=O)(OP(=O)(OCC1OC(C(C1O)O)n1ccc(=O)[nH]c1=O)O)O |
| Reactions | OSR0955 |
| Database Links | |
|---|---|
| KEGG | C18094 |
| Pubchem Compound | 46174047 |
| Pubchem Substance | 96024311 |