RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1765 |
| Common Name | trans-Zeatin riboside diphosphate |
| Formula | C15H23N5O11P2 |
| Formula at pH 7.2 (Predicted) | C15H20N5O11P23- |
| Molecular Weight | 511.317 |
| Structure |  |
| SMILES | C1(C(O)C(O)C(O1)COP(=O)(O)OP(O)(O)=O)n2(c3(c(nc2)c(ncn3)NCC=C(C)CO)) |
| Reactions | OSR1002 OSR1055 OSR2462 OSR2735 |
| Pathways | |
|---|---|
| KEGG | rn00908 |
| Database Links | |
|---|---|
| Gramene | CPD-4204 |
| KEGG | C16429 |
| Pubchem Compound | 24892783 |
| Pubchem Substance | 47205726 |