RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1766 |
| Common Name | L-2-Aminoadipate adenylate |
| Synonyms Names | 5-Adenylyl-2-aminoadipate ;alpha-Aminoadipoyl-C6-AMP |
| Formula | C16H23N6O10P |
| Formula at pH 7.2 (Predicted) | C16H22N6O10P- |
| Molecular Weight | 490.362 |
| Structure |  |
| SMILES | O=C(OP(=O)(OCC1OC(C(C1O)O)n1cnc2c1ncnc2N)O)CCCC(C(=O)O)N |
| Reactions | OSR0988 OSR1164 |
| Pathways | |
|---|---|
| KEGG | rn00300 rn01100 |
| Database Links | |
|---|---|
| KEGG | C05560 |
| Pubchem Compound | 440724 |
| Pubchem Substance | 7891 |