RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1772 |
| Common Name | N,N'-diacetylchitobiose |
| Formula | C16H28N2O11 |
| Formula at pH 7.2 (Predicted) | C16H28N2O11 |
| Structure |  |
| SMILES | CC(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(C)=O)[C@@H]1O |
| Reactions | OSR1411 OSR1551 OSR2287 OSR2290 OSR2402 OSR2820 |
| Pathways | |
|---|---|
| KEGG | rn00520 |