RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1774 |
| Common Name | 10-Formyltetrahydrofolate |
| Synonyms Names | 10-Formyl-THF |
| Formula | C20H23N7O7 |
| Formula at pH 7.2 (Predicted) | C20H21N7O72- |
| Molecular Weight | 473.439 |
| Structure |  |
| SMILES | NC1=NC(=O)C2=C(NCC(CN(C=O)C3=CC=C(C=C3)C(=O)NC(CCC(O)=O)C(O)=O)N2)N1 |
| Reactions | OSR0971 OSR1008 OSR1618 OSR1719 OSR2039 OSR2562 OSR2726 |
| Pathways | |
|---|---|
| KEGG | rn00630 rn00670 rn00230 rn01100 rn01110 rn00720 rn01120 rn00970 |
| Metacyc | 1CMET2-PWY PWY-2201 FOLSYN-PWY DENOVOPURINE2-PWY PWY-841 PWY-3841 PWY-2161 |
| Database Links | |
|---|---|
| KEGG | C00234 |
| ChEBI | 15637 |