RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1775 |
| Common Name | 5-Formyltetrahydrofolate |
| Synonyms Names | L(-)-5-Formyl-5,6,7,8-tetrahydrofolic acid ;Folinic acid |
| Formula | C20H23N7O7 |
| Formula at pH 7.2 (Predicted) | C20H21N7O72- |
| Molecular Weight | 473.439 |
| Structure |  |
| SMILES | C([CH]1(N(C=O)c2(c(NC1)nc(N)[nH]c2=O)))Nc3(ccc(cc3)C(=O)NC(C(O)=O)CCC(O)=O) |
| Reactions | OSR0973 OSR0974 OSR1985 OSR2000 |
| Pathways | |
|---|---|
| KEGG | rn00670 rn01100 |
| Metacyc | PWY-3841 PWY-2201 |
| Database Links | |
|---|---|
| KEGG | C03479 |
| ChEBI | 15640 |