RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1776 |
| Common Name | CDP-choline |
| Synonyms Names | Cytidine 5'-diphosphocholine ;Citicoline |
| Formula | C14H26N4O11P2 |
| Formula at pH 7.2 (Predicted) | C14H25N4O11P2- |
| Molecular Weight | 488.324 |
| Structure |  |
| SMILES | C(OP(O)(=O)OP(O)(=O)OCC[N+1](C)(C)C)C1(OC(C(O)C1O)n2(c(=O)nc(N)cc2)) |
| Reactions | OSR1187 OSR1287 |
| Pathways | |
|---|---|
| KEGG | rn00564 rn01100 |
| Metacyc | PHOSLIPSYN2-PWY PWY-3561 |
| Database Links | |
|---|---|
| KEGG | C00307 |
| ChEBI | 16436 |