RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1777 |
| Common Name | CMP-N-trimethyl-2-aminoethylphosphonate |
| Synonyms Names | CMP-2-trimethylaminoethylphosphonate |
| Formula | C14H27N4O10P2 |
| Formula at pH 7.2 (Predicted) | C14H25N4O10P2- |
| Molecular Weight | 473.332 |
| Structure |  |
| SMILES | OC1C(COP(=O)(OP(=O)(CC[N+](C)(C)C)O)O)OC(C1O)n1ccc(nc1=O)N |
| Reactions | OSR1171 |
| Pathways | |
|---|---|
| KEGG | rn00440 |
| Database Links | |
|---|---|
| KEGG | C05674 |
| Pubchem Compound | 440755 |
| Pubchem Substance | 7981 |