RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1787 |
| Common Name | 4-(Cytidine 5'-diphospho)-2-C-methyl-D-erythritol |
| Formula | C14H25N3O14P2 |
| Formula at pH 7.2 (Predicted) | C14H23N3O14P22- |
| Molecular Weight | 521.308 |
| Structure |  |
| SMILES | CC(O)(CO)C(O)COP(=O)(O)OP(=O)(O)OCC1(OC(C(O)C1O)n2(c(=O)nc(N)cc2)) |
| Reactions | OSR1211 OSR2003 |
| Pathways | |
|---|---|
| KEGG | rn00900 rn01100 rn01110 |
| Metacyc | NONMEVIPP-PWY |
| Database Links | |
|---|---|
| KEGG | C11435 |
| ChEBI | 16578 |