RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1792 |
| Common Name | 1-Nitro-7-glutathionyl-8-hydroxy-7,8-dihydronaphthalene |
| Formula | C20H24N4O9S |
| Formula at pH 7.2 (Predicted) | C20H23N4O9S- |
| Molecular Weight | 496.491 |
| Structure |  |
| SMILES | O=C(NC(C(=O)NCC(=O)O)CSC1C=Cc2c(C1O)c(ccc2)[N+](=O)[O-])CCC(C(=O)O)N |
| Reactions | OSR0984 |
| Pathways | |
|---|---|
| KEGG | rn00980 |
| Database Links | |
|---|---|
| KEGG | C14804 |
| Pubchem Compound | 11954055 |
| Pubchem Substance | 17395802 |