RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1794 |
| Common Name | 3-Carboxy-1-hydroxypropyl-ThPP |
| Formula | C16H25N4O10P2S |
| Formula at pH 7.2 (Predicted) | C16H22N4O10P2S2- |
| Molecular Weight | 527.403 |
| Structure |  |
| SMILES | OC(=O)CCC(c1sc(c([n+]1Cc1cnc(nc1N)C)C)CCOP(=O)(OP(=O)(O)O)O)O |
| Reactions | OSR1019 OSR1494 |
| Pathways | |
|---|---|
| KEGG | rn00020 rn01120 |
| Database Links | |
|---|---|
| KEGG | C05381 |
| ChEBI | 1463 |
| Pubchem Compound | 440649 |
| Pubchem Substance | 7755 |