RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1798 |
| Common Name | DNA |
| Synonyms Names | DNAn ;DNAn+1 ;(Deoxyribonucleotide)n ;(Deoxyribonucleotide)m ;(Deoxyribonucleotide)n+m ;Deoxyribonucleic acid ;DNA ;DNA(N) |
| Formula | C10H17O8PR2(C5H8O5PR)n |
| Formula at pH 7.2 (Predicted) | C15H23O13P2R37- |
| Structure |  |
| SMILES | OCC1OC(CC1O[P](O)(=O)OCC2OC(CC2O[P](O)(=O)OCC3OC(CC3O)[R])[R])[R] |
| Reactions | OSR1536 OSR1561 OSR1564 OSR1570 OSR2210 OSR2466 OSR3048 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 rn00230 |
| Database Links | |
|---|---|
| KEGG | C00039 |
| ChEBI | 16991 |