RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1800 |
| Common Name | Phosphatidylinositol-3,4,5-trisphosphate |
| Synonyms Names | C05981 ;1-Phosphatidyl-1D-myo-inositol 3,4,5-trisphosphate ;1,2-Diacyl-sn-glycero-3-phospho-(1'-myo-inositol-3',4',5'-bisphosphate) |
| Formula | C11H20O22P4R2 |
| Formula at pH 7.2 (Predicted) | C11H13O22P4R2 |
| Structure |  |
| SMILES | OC1C(O[P](O)(=O)OCC(COC(=O)[R])OC(=O)[R])C(O)C(O[P](O)(O)=O)C(O[P](O)(O)=O)C1O[P](O)(O)=O |
| Reactions | OSR1031 |
| Pathways | |
|---|---|
| KEGG | rn00562 |
| Database Links | |
|---|---|
| KEGG | C05981 |
| Pubchem Substance | 8260 |