RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1801 |
| Common Name | UDP-D-galacturonate |
| Synonyms Names | UDPgalacturonate |
| Formula | C15H22N2O18P2 |
| Formula at pH 7.2 (Predicted) | C15H19N2O18P23- |
| Molecular Weight | 580.285 |
| Structure |  |
| SMILES | c1(n(c(=O)[nH]c(c1)=O)C2(OC(C(O)C2O)COP(=O)(O)OP(=O)(O)OC3(C(O)C(O)C(O)C(O3)C(O)=O))) |
| Reactions | OSR0994 OSR1693 |
| Pathways | |
|---|---|
| KEGG | rn00500 rn00520 rn01100 rn01110 |
| Metacyc | PWY-6415 PWY-4861 |
| Database Links | |
|---|---|
| KEGG | C00617 |
| ChEBI | 16085 |
| Pubchem Compound | 23724463 |
| Pubchem Substance | 3891 |