RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1804 |
| Common Name | Phosphoribosyl-AMP |
| Synonyms Names | N1-(5-Phospho-D-ribosyl)-AMP ;1-(5-Phosphoribosyl)-AMP |
| Formula | C15H23N5O14P2 |
| Formula at pH 7.2 (Predicted) | C15H19N5O14P24- |
| Molecular Weight | 559.316 |
| Structure |  |
| SMILES | C(OP(O)(=O)O)C1(OC(C(O)C(O)1)n3(c2(ncn(c(=N)c2nc3)C4(OC(C(O)C(O)4)COP(O)(=O)O)))) |
| Reactions | OSR1028 OSR1229 |
| Pathways | |
|---|---|
| KEGG | rn00340 rn01100 rn01110 |
| Metacyc | HISTSYN-PWY |
| Database Links | |
|---|---|
| KEGG | C02741 |
| ChEBI | 18374 |