RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1805 |
| Common Name | UDP-L-rhamnose |
| Formula | C15H24N2O16P2 |
| Formula at pH 7.2 (Predicted) | C15H22N2O16P22- |
| Molecular Weight | 550.302 |
| Structure |  |
| SMILES | OC1C(COP(=O)(OP(=O)(OC2OC(C)C(C(C2O)O)O)O)O)OC(C1O)n1ccc(=O)[nH]c1=O |
| Reactions | OSR2141 OSR2471 |
| Pathways | |
|---|---|
| KEGG | rn00944 rn01100 rn01110 rn00520 |
| Database Links | |
|---|---|
| KEGG | C02199 |
| ChEBI | 17454 |
| Pubchem Compound | 23724469 |
| Pubchem Substance | 5267 |