RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1813 |
| Common Name | UDP-D-galacto-1,4-furanose |
| Formula | C15H24N2O17P2 |
| Formula at pH 7.2 (Predicted) | C15H22N2O17P22- |
| Molecular Weight | 566.305 |
| Structure |  |
| SMILES | OCC(C1OC(C(C1O)O)OP(=O)(OP(=O)(OCC1OC(C(C1O)O)n1ccc(=O)[nH]c1=O)O)O)O |
| Reactions | OSR1006 |
| Pathways | |
|---|---|
| Metacyc | OANTIGEN-PWY |