RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1817 |
| Common Name | Phytol |
| Formula | C20H40O |
| Formula at pH 7.2 (Predicted) | C20H40O |
| Molecular Weight | 296.531 |
| Structure |  |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)=CCO |
| Reactions | OSR2505 OSR2510 OSR2513 |
| Pathways | |
|---|---|
| KEGG | rn00860 rn01100 rn01110 |
| Metacyc | PWY-5098 |
| Database Links | |
|---|---|
| KEGG | C01389 |
| ChEBI | 17327 |
| Pubchem Compound | 5280435 |
| Pubchem Substance | 4582 |