RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1824 |
| Common Name | 2-Methyl-1-hydroxybutyl-ThPP |
| Synonyms Names | 2-Methyl-1-hydroxybutyl-TPP |
| Formula | C17H29N4O8P2S |
| Formula at pH 7.2 (Predicted) | C17H27N4O8P2S- |
| Molecular Weight | 511.447 |
| Structure |  |
| SMILES | CCC(C(c1sc(c([n+]1Cc1cnc(nc1N)C)C)CCOP(=O)(OP(=O)(O)O)O)O)C |
| Reactions | OSR1050 OSR1563 |
| Pathways | |
|---|---|
| KEGG | rn00280 rn01100 rn01110 |
| Database Links | |
|---|---|
| KEGG | C15978 |
| Pubchem Compound | 23724627 |
| Pubchem Substance | 47205291 |