RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1827 |
| Common Name | C25-Allenic-apo-aldehyde |
| Synonyms Names | C25-allenic-apo-aldehyde |
| Formula | C25H34O3;C25H36O3 |
| Formula at pH 7.2 (Predicted) | C25H34O3 |
| Molecular Weight | 382.536 |
| Structure |  |
| SMILES | O=CC(=CC=CC=C(C=CC=C(C=C=C1C(C)(C)CC(CC1(C)O)O)C)C)C;OCC(=CC=CC=C(C=CC=C(C=C=C1C(C)(C)CC(CC1(C)O)O)C)C)C |
| Reactions | OSR1932 |
| Pathways | |
|---|---|
| KEGG | rn00906 rn01110 |
| Metacyc | PWY-695 |
| Database Links | |
|---|---|
| KEGG | C14044 |
| ChEBI | 34596 |
| Pubchem Compound | 5282319 |
| Pubchem Substance | 854282 |