RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1833 |
| Common Name | dTDP-galactose |
| Synonyms Names | dTDP-D-galactose |
| Formula | C16H26N2O16P2 |
| Formula at pH 7.2 (Predicted) | C16H24N2O16P22- |
| Molecular Weight | 564.329 |
| Structure |  |
| SMILES | OCC1OC(OP(=O)(OP(=O)(OCC2OC(CC2O)n2cc(C)c(=O)[nH]c2=O)O)O)C(C(C1O)O)O |
| Reactions | OSR1030 |
| Database Links | |
|---|---|
| KEGG | C02097 |
| Pubchem Compound | 439651 |
| Pubchem Substance | 5181 |