RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1834 |
| Common Name | CMP-3-deoxy-D-manno-octulosonate |
| Synonyms Names | CMP-KDO |
| Formula | C17H26N3O15P |
| Formula at pH 7.2 (Predicted) | C17H24N3O15P2- |
| Molecular Weight | 543.373 |
| Structure |  |
| SMILES | C1C(C(C(OC1(C(=O)O)OP(=O)(O)OCC2C(C(C(O2)N3C=CC(=NC3=O)N)O)O)C(CO)O)O)O |
| Reactions | OSR1297 |
| Pathways | |
|---|---|
| KEGG | rn00540 rn01100 |
| Metacyc | PWY-5111 |
| Database Links | |
|---|---|
| KEGG | C04121 |
| ChEBI | 18014 |
| Pubchem Compound | 445888 |
| Pubchem Substance | 6808 |