RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1840 |
| Common Name | ADP-glucose |
| Synonyms Names | Adenosine diphosphoglucose ;ADPglucose ;ADP-D-glucose |
| Formula | C16H25N5O15P2; C16H24N8O15P2; C16H23N5O15P2 |
| Formula at pH 7.2 (Predicted) | C16H23N5O15P22- |
| Molecular Weight | 589.342 |
| SMILES | C1(C(O)C(O)C(O)C(O1)CO)OP(=O)(O)OP(=O)(O)OCC2(OC(C(O)C(O)2)n3(cnc4(c3c(N)ncn4))); C1=NC2=C(C(=N1)N)N=C(N2C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OC4C(C(C(C(O4)CO)O)O)O)O)O)N=[N+]=[N-]; c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)([O-])OP(=O)([O-])O[C@@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)N |
| Reactions | OSR1274 OSR1321 OSR1554 |
| Pathways | |
|---|---|
| KEGG | rn00500 rn01100 rn01110 rn00520 |
| Metacyc | PWY-622 GLYCOGENSYNTH-PWY PWY-3821 SUCSYN-PWY PWY-621 PWY-3801 |
| Database Links | |
|---|---|
| KEGG | C00498 |
| ChEBI | 15751 |