RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1843 |
| Common Name | UDP-6-sulfoquinovose |
| Formula | C15H24N2O19P2S |
| Formula at pH 7.2 (Predicted) | C15H21N2O19P2S3- |
| Molecular Weight | 630.366 |
| Structure |  |
| SMILES | OC1C(O)C(C[S](O)(=O)=O)OC(O[P](O)(=O)O[P](O)(=O)OCC2OC(C(O)C2O)N3C=CC(=O)NC3=O)C1O |
| Reactions | OSR1098 OSR1428 OSR1435 |
| Pathways | |
|---|---|
| KEGG | rn00520 rn00561 rn01100 |
| Metacyc | PWY-401 |
| Database Links | |
|---|---|
| KEGG | C11521 |
| ChEBI | 15855 |
| Pubchem Compound | 443244 |
| Pubchem Substance | 13689 |