RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1846 |
| Common Name | GDP-L-galactose |
| Formula | C16H25N5O16P2 |
| Formula at pH 7.2 (Predicted) | C16H24N5O16P2- |
| Molecular Weight | 605.341 |
| Structure |  |
| SMILES | C1=NC2=C(N1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OC4C(C(C(C(O4)CO)O)O)O)O)O)NC(=NC2=O)N |
| Reactions | OSR1059 OSR1060 OSR1147 OSR1237 |
| Pathways | |
|---|---|
| KEGG | rn00053 rn00520 rn01100 rn01110 |
| Metacyc | PWY-882 PWY4FS-12 PWY4FS-13 PWY-5115 |
| Database Links | |
|---|---|
| KEGG | C02280 |
| ChEBI | 18038 |
| Pubchem Compound | 439695 |
| Pubchem Substance | 5337 |