RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1848 |
| Common Name | GDP-L-gulose |
| Synonyms Names | GDP-L-gulose |
| Formula | C16H25N5O16P2 |
| Formula at pH 7.2 (Predicted) | C16H23N5O16P22- |
| Molecular Weight | 605.341 |
| Structure |  |
| SMILES | C(O)C1(OC(C(O)C(O)C1O)OP(=O)(O)OP(=O)(O)OCC2(OC(C(O)C2O)n3(c4(c(nc3)c(=O)[nH]c(n4)N)))) |
| Reactions | OSR1051 OSR1059 |
| Pathways | |
|---|---|
| KEGG | rn00053 rn00520 rn01110 rn01100 |
| Metacyc | PWY-882 PWY4FS-12 PWY4FS-13 PWY-5115 |
| Database Links | |
|---|---|
| Gramene | CPD-7078 |
| KEGG | C15925 |
| Pubchem Compound | 23724606 |
| Pubchem Substance | 47205243 |