RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1850 |
| Common Name | 9-alpha-copalyl diphosphate |
| Synonyms Names | 9alpha-Copalyl diphosphate ;syn-Copalyl diphosphate |
| Formula | C20H36O7P2 |
| Formula at pH 7.2 (Predicted) | C20H34O7P22- |
| Molecular Weight | 450.443 |
| Structure |  |
| SMILES | CC(/CCC1C(=C)CCC2C(C)(C)CCCC12C)=CCO[P](O)(=O)O[P](O)(O)=O |
| Reactions | OSR0989 OSR0993 OSR1069 OSR1079 OSR1081 |
| Pathways | |
|---|---|
| KEGG | rn00904 rn01110 |
| Metacyc | PWY4KF-48 PWY4KF-11492 PWY-2981 |
| Database Links | |
|---|---|
| KEGG | C11902 |
| ChEBI | 29739 |
| Pubchem Compound | 5281991 |
| Pubchem Substance | 14064 |