RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1852 |
| Common Name | ent-Copalyl diphosphate |
| Synonyms Names | (-)-Copalyl diphosphate |
| Formula | C20H36O7P2 |
| Formula at pH 7.2 (Predicted) | C20H34O7P22- |
| Molecular Weight | 450.443 |
| Structure |  |
| SMILES | CC(=CCOP(O)(=O)OP(O)(=O)O)CCC1(C(=C)CC[CH]2(C1(C)CCCC(C)(C)2)) |
| Reactions | OSR1065 OSR1072 OSR1075 OSR1078 OSR2214 OSR2216 |
| Pathways | |
|---|---|
| KEGG | rn00904 rn01110 rn01100 |
| Metacyc | PWY-2981 PWY4KF-2307 PWY-5032 PWY4KF-1 |
| Database Links | |
|---|---|
| KEGG | C06089 |
| ChEBI | 28151 |
| Pubchem Compound | 5280897 |
| Pubchem Substance | 8355 |