RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1857 |
| Common Name | Pectate |
| Synonyms Names | Pectic acid ;alpha-D-Polygalacturonic acid ;Poly(1,4-alpha-D-galacturonate) ;Poly(1,4-alpha-D-galacturonate)(n) ;(1,4-alpha-D-Galacturonide)n ;(1,4-alpha-D-Galacturonosyl)n ;De-esterified pectin ;1-4-alpha-D-galacturonosyl |
| Formula | C12H18O13(C6H8O6)n-2; C18H26O19 |
| Formula at pH 7.2 (Predicted) | C18H23O193- |
| Molecular Weight | 194.141 |
| Structure |  |
| SMILES | C1(C(C(OC(C1O)OC2C(C(C(OC2C(=O)O)OC3C(C(C(OC3C(=O)O)O)O)O)O)O)C(=O)O)O)O; ?C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)OC3(C(OC(C(C3O)O)O)C(=O)O))C(=O)O))C(O)=O |
| Reactions | OSR1108 OSR1180 OSR1512 OSR1534 OSR2408 |
| Pathways | |
|---|---|
| KEGG | rn00040 rn00500 rn01100 |
| Metacyc | PWY-1081 |
| Database Links | |
|---|---|
| KEGG | C00470 |
| ChEBI | 15446 |
| Pubchem Compound | 24892720;445929 |
| Pubchem Substance | 3753 |