RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1858 |
| Common Name | 4-Glutathionyl cyclophosphamide |
| Formula | C17H30Cl2N5O8PS |
| Formula at pH 7.2 (Predicted) | C17H29Cl2N5O8PS- |
| Molecular Weight | 566.394 |
| Structure |  |
| SMILES | ClCCN(P1(=O)OCCC(N1)SCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N)CCCl |
| Reactions | OSR1132 |
| Pathways | |
|---|---|
| KEGG | rn00982 |
| Database Links | |
|---|---|
| KEGG | C11583 |
| Pubchem Compound | 443288 |
| Pubchem Substance | 13748 |