RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1872 |
| Common Name | Ribonucleic acid |
| Synonyms Names | (Ribonucleotide)m ;(Ribonucleotide)n ;RNA(linear) ;RNAn ;(Ribonucleotide)n+m ;RNAn+1 ;C00046 ;RNA ;RNA ;RNA(N) |
| Formula | C10H18O13P2R2(C5H8O6PR)n |
| Formula at pH 7.2 (Predicted) | C15H22O19P3R3 |
| Structure |  |
| SMILES | OC1C(OC(CO[P](O)(=O)OC2C(O)C(OC2CO[P](O)(=O)OC3C(O)C(OC3CO[P](O)(O)=O)[R])[R])C1O)[R] |
| Reactions | OSR1616 OSR1627 OSR1646 OSR1652 OSR1681 OSR1743 OSR1755 OSR1788 OSR1804 |
| Pathways | |
|---|---|
| KEGG | rn00240 rn01100 rn00230 |
| Database Links | |
|---|---|
| KEGG | C00046 |
| Pubchem Substance | 3348 |