RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1875 |
| Common Name | 3-geranylgeranyl-4-hydroxybenzoate |
| Formula | C27H38O3 |
| Formula at pH 7.2 (Predicted) | C27H37O3- |
| Structure |  |
| SMILES | CC(C)=CCCC(C)=CCC(C=C(/C)CCC=C(C)C)C1=C(O)C=CC(=C1)C(O)=O |
| Reactions | OSR1430 |
| Pathways | |
|---|---|
| KEGG | rn01110 rn01100 rn00130 |
| Metacyc | PWY-5872 PWY-5857 PWY3O-19 PWY-5873 PWY-5855 PWY-5870 UBISYN-PWY PWY-5871 PWY-5856 |