RiceNetDB
RiceNetDB is currently the most comprehensive regulatory database on Oryza Sativa based on genome annotation. It was displayed in three levels: GEM, PPIs and GRNs to facilitate biomolecular regulatory analysis and gene-metabolite mapping.
| General Information | |
|---|---|
| Compound ID | OSC1878 |
| Common Name | Tetrahydrogeranylgeranyl diphosphate |
| Formula | C20H40O7P2 |
| Formula at pH 7.2 (Predicted) | C20H38O7P22- |
| Molecular Weight | 454.475 |
| Structure |  |
| SMILES | CC(C)=CCCC(C)CCCC(C)CCCC(C)=CCOP(O)(=O)OP(=O)(O)O |
| Reactions | OSR2558 OSR2581 |
| Pathways | |
|---|---|
| Metacyc | PWY-5063 |
| Database Links | |
|---|---|
| Gramene | CPD-7003 |
| KEGG | C17440 |
| Pubchem Compound | 25244233 |
| Pubchem Substance | 96023790 |